| MolName | 2-(azocan-1-ium-1-yl)-N-[(Z)-thiophen-3-ylmethylideneamino]acetamide |
| MolecularFormula | C14H22N3OS |
| Smiles | O=C(C[NH+]1CCCCCCC1)N/N=C\c1cscc1 |
| InChI | InChI=1S/C14H21N3OS/c18-14(16-15-10-13-6-9-19-12-13)11-17-7-4-2-1-3-5-8-17/h6,9-10,12H,1-5,7-8,11H2,(H,16,18)/p+1 |
| InChIK | UURBHBOUKJIVJD-UHFFFAOYSA-O |
| TotalMolweight | 280.415 |
| Molweight | 280.415 |
| MonoisotopicMass | 280.148357 |
| CLogP | 1.5768 |
| CLogS | -3.07 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 244.09 |
| Relative PSA | 0.303 |
| PolarSurfaceArea | 74.14 |
| Druglikeness | -0.73967 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.68421 |
| Fragments | 1 |
| Non HAtoms | 19 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 1 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 5 |
| Sp3Atoms | 9 |
| Symmetricatoms | 3 |
| Amines | 1 |
| AlkylAmines | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-(azocan-1-ium-1-yl)-N-[(Z)-thiophen-3-ylmethylideneamino]acetamide | 2 - 2-(azocan-1-ium-1-yl)-N-[(Z)-thiophen-3-ylmethylideneamino]acetamide