| MolName | (2R,8S)-6-[(Z)-(2,4-dichlorophenyl)methylideneamino]-2-phenyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
| MolecularFormula | C27H20N4O2Cl2 |
| Smiles | O=C(CN(C([C@@H]1Cc2c3[nH]c4c2cccc4)=O)/N=C\c(ccc(Cl)c2)c2Cl)N1[C@@H]3c1ccccc1 |
| InChI | InChI=1S/C27H20Cl2N4O2/c28-18-11-10-17(21(29)12-18)14-30-32-15-24(34)33-23(27(32)35)13-20-19-8-4-5-9-22(19)31-25(20)26(33)16-6-2-1-3-7-16/h1-12,14,23,26,31H,13,15H2/t23-,26+/m0/s1 |
| InChIK | UUTUXOVPQLERGW-JYFHCDHNSA-N |
| TotalMolweight | 503.388 |
| Molweight | 503.388 |
| MonoisotopicMass | 502.09633 |
| CLogP | 5.1547 |
| CLogS | -6.328 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 354.17 |
| Relative PSA | 0.16568 |
| PolarSurfaceArea | 68.77 |
| Druglikeness | 7.2684 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.45714 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| StereoCenters | 2 |
| Rotatable Bond | 3 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| Amides | 1 |
| Aromatic Nitrogens | 1 |
| StereoCon | this enantiomer |
Click to Load Molecule:
1 - (2R,8S)-6-[(Z)-(2,4-dichlorophenyl)methylideneamino]-2-phenyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione | 2 - (2R,8S)-6-[(Z)-(2,4-dichlorophenyl)methylideneamino]-2-phenyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione