| MolName | N-[(Z)-3-[(2Z)-2-[(5-bromofuran-2-yl)methylidene]hydrazinyl]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| MolecularFormula | C21H15N4O5Br |
| Smiles | [O-][N+](c1ccc(/C=C(/C(N/N=C\c(o2)ccc2Br)=O)\NC(c2ccccc2)=O)cc1)=O |
| InChI | InChI=1S/C21H15BrN4O5/c22-19-11-10-17(31-19)13-23-25-21(28)18(24-20(27)15-4-2-1-3-5-15)12-14-6-8-16(9-7-14)26(29)30/h1-13H,(H,24,27)(H,25,28) |
| InChIK | UVIFERAYLTZJQN-UHFFFAOYSA-N |
| TotalMolweight | 483.277 |
| Molweight | 483.277 |
| MonoisotopicMass | 482.022582 |
| CLogP | 3.908 |
| CLogS | -6.205 |
| H Acceptors | 9 |
| H Donors | 2 |
| TotalSurfaceArea | 332.66 |
| Relative PSA | 0.31576 |
| PolarSurfaceArea | 129.52 |
| Druglikeness | -0.31219 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.51613 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 1 |
| Symmetricatoms | 4 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-3-[(2Z)-2-[(5-bromofuran-2-yl)methylidene]hydrazinyl]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide | 2 - N-[(Z)-3-[(2Z)-2-[(5-bromofuran-2-yl)methylidene]hydrazinyl]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide