| MolName | 4-N-(4-fluorophenyl)-2-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine |
| MolecularFormula | C22H21N8O4F |
| Smiles | [O-][N+](c1c(/C=N\Nc2nc(Nc(cc3)ccc3F)nc(N3CCCCC3)n2)cc2OCOc2c1)=O |
| InChI | InChI=1S/C22H21FN8O4/c23-15-4-6-16(7-5-15)25-20-26-21(28-22(27-20)30-8-2-1-3-9-30)29-24-12-14-10-18-19(35-13-34-18)11-17(14)31(32)33/h4-7,10-12H,1-3,8-9,13H2,(H2,25,26,27,28,29) |
| InChIK | UVNDSWJHJUPXEY-UHFFFAOYSA-N |
| TotalMolweight | 480.459 |
| Molweight | 480.459 |
| MonoisotopicMass | 480.16698 |
| CLogP | 5.4053 |
| CLogS | -7.39 |
| H Acceptors | 12 |
| H Donors | 2 |
| TotalSurfaceArea | 352.62 |
| Relative PSA | 0.34402 |
| PolarSurfaceArea | 142.61 |
| Druglikeness | -3.9324 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.48571 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 13 |
| Electronegative Atoms | 13 |
| Rotatable Bond | 7 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 9 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-N-(4-fluorophenyl)-2-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine | 2 - 4-N-(4-fluorophenyl)-2-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine