| MolName | 3-[(Z)-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylideneamino]-1,3-diazaspiro[4.5]decane-2,4-dione |
| MolecularFormula | C22H21N5O2S |
| Smiles | O=C(C1(CCCCC1)NC1=O)N1/N=C\c1cn(-c2ccccc2)nc1-c1cccs1 |
| InChI | InChI=1S/C22H21N5O2S/c28-20-22(11-5-2-6-12-22)24-21(29)27(20)23-14-16-15-26(17-8-3-1-4-9-17)25-19(16)18-10-7-13-30-18/h1,3-4,7-10,13-15H,2,5-6,11-12H2,(H,24,29) |
| InChIK | UVPBJFRHZRONIZ-UHFFFAOYSA-N |
| TotalMolweight | 419.508 |
| Molweight | 419.508 |
| MonoisotopicMass | 419.141595 |
| CLogP | 3.0933 |
| CLogS | -5.17 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 310.91 |
| Relative PSA | 0.29205 |
| PolarSurfaceArea | 107.83 |
| Druglikeness | 3.207 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 6 |
| Symmetricatoms | 4 |
| Amides | 1 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(Z)-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylideneamino]-1,3-diazaspiro[4.5]decane-2,4-dione | 2 - 3-[(Z)-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylideneamino]-1,3-diazaspiro[4.5]decane-2,4-dione