| MolName | 2-bromo-4-nitro-6-[(Z)-(3-phenyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]phenolate |
| MolecularFormula | C15H9N5O3BrS |
| Smiles | [O-]c(c(/C=N\N(C(c1ccccc1)=NN1)C1=S)cc([N+]([O-])=O)c1)c1Br |
| InChI | InChI=1S/C15H10BrN5O3S/c16-12-7-11(21(23)24)6-10(13(12)22)8-17-20-14(18-19-15(20)25)9-4-2-1-3-5-9/h1-8,22H,(H,19,25)/p-1 |
| InChIK | UVQZGPPDBVHAND-UHFFFAOYSA-M |
| TotalMolweight | 419.238 |
| Molweight | 419.238 |
| MonoisotopicMass | 417.960946 |
| CLogP | 1.1749 |
| CLogS | -5.449 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 271.55 |
| Relative PSA | 0.40777 |
| PolarSurfaceArea | 140.96 |
| Druglikeness | -3.4335 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.52 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-bromo-4-nitro-6-[(Z)-(3-phenyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]phenolate | 2 - 2-bromo-4-nitro-6-[(Z)-(3-phenyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]phenolate