| MolName | N-[(Z)-pyridin-3-ylmethylideneamino]-1H-benzimidazol-2-amine |
| MolecularFormula | C13H11N5 |
| Smiles | C(c1cccnc1)=N\Nc1nc(cccc2)c2[nH]1 |
| InChI | InChI=1S/C13H11N5/c1-2-6-12-11(5-1)16-13(17-12)18-15-9-10-4-3-7-14-8-10/h1-9H,(H2,16,17,18) |
| InChIK | UWLQJXXNMPYPEU-UHFFFAOYSA-N |
| TotalMolweight | 237.265 |
| Molweight | 237.265 |
| MonoisotopicMass | 237.101445 |
| CLogP | 3.8091 |
| CLogS | -2.836 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 190.93 |
| Relative PSA | 0.30849 |
| PolarSurfaceArea | 65.96 |
| Druglikeness | 3.2659 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 18 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-pyridin-3-ylmethylideneamino]-1H-benzimidazol-2-amine | 2 - N-[(Z)-pyridin-3-ylmethylideneamino]-1H-benzimidazol-2-amine