| MolName | 4-morpholin-4-yl-N-[(Z)-[(E)-3-(3-nitrophenyl)prop-2-enylidene]amino]-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine |
| MolecularFormula | C20H24N8O3 |
| Smiles | [O-][N+](c1cc(/C=C/C=N\Nc2nc(N3CCOCC3)nc(N3CCCC3)n2)ccc1)=O |
| InChI | InChI=1S/C20H24N8O3/c29-28(30)17-7-3-5-16(15-17)6-4-8-21-25-18-22-19(26-9-1-2-10-26)24-20(23-18)27-11-13-31-14-12-27/h3-8,15H,1-2,9-14H2,(H,22,23,24,25) |
| InChIK | UWPAZWJXUVZQIY-UHFFFAOYSA-N |
| TotalMolweight | 424.464 |
| Molweight | 424.464 |
| MonoisotopicMass | 424.197137 |
| CLogP | 3.008 |
| CLogS | -4.912 |
| H Acceptors | 11 |
| H Donors | 1 |
| TotalSurfaceArea | 329.37 |
| Relative PSA | 0.31393 |
| PolarSurfaceArea | 124.59 |
| Druglikeness | -2.0201 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.54839 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 10 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-morpholin-4-yl-N-[(Z)-[(E)-3-(3-nitrophenyl)prop-2-enylidene]amino]-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine | 2 - 4-morpholin-4-yl-N-[(Z)-[(E)-3-(3-nitrophenyl)prop-2-enylidene]amino]-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine