| MolName | 2-(4-chlorophenoxy)-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]acetamide |
| MolecularFormula | C16H12N2O2ClF3 |
| Smiles | O=C(COc(cc1)ccc1Cl)N/N=C\c1c(C(F)(F)F)cccc1 |
| InChI | InChI=1S/C16H12ClF3N2O2/c17-12-5-7-13(8-6-12)24-10-15(23)22-21-9-11-3-1-2-4-14(11)16(18,19)20/h1-9H,10H2,(H,22,23) |
| InChIK | UWPCPTZXVXHSGX-UHFFFAOYSA-N |
| TotalMolweight | 356.73 |
| Molweight | 356.73 |
| MonoisotopicMass | 356.053939 |
| CLogP | 4.2308 |
| CLogS | -5.015 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 255.63 |
| Relative PSA | 0.17999 |
| PolarSurfaceArea | 50.69 |
| Druglikeness | -2.9622 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.625 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 3 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - 2-(4-chlorophenoxy)-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]acetamide | 2 - 2-(4-chlorophenoxy)-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]acetamide