| MolName | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(4-chlorophenyl)sulfanylmethyl]-N-[(Z)-(3-fluorophenyl)methylideneamino]triazole-4-carboxamide |
| MolecularFormula | C19H14N8O2ClFS |
| Smiles | Nc1nonc1-n1nnc(C(N/N=C\c2cc(F)ccc2)=O)c1CSc(cc1)ccc1Cl |
| InChI | InChI=1S/C19H14ClFN8O2S/c20-12-4-6-14(7-5-12)32-10-15-16(24-28-29(15)18-17(22)26-31-27-18)19(30)25-23-9-11-2-1-3-13(21)8-11/h1-9H,10H2,(H2,22,26)(H,25,30) |
| InChIK | UWPLGCJRJPBWCI-UHFFFAOYSA-N |
| TotalMolweight | 472.891 |
| Molweight | 472.891 |
| MonoisotopicMass | 472.063297 |
| CLogP | 4.4176 |
| CLogS | -4.931 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 341.98 |
| Relative PSA | 0.39075 |
| PolarSurfaceArea | 162.41 |
| Druglikeness | 0.95825 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.53125 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 13 |
| Electronegative Atoms | 13 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 5 |
| StereoCon |
Click to Load Molecule:
1 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(4-chlorophenyl)sulfanylmethyl]-N-[(Z)-(3-fluorophenyl)methylideneamino]triazole-4-carboxamide | 2 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(4-chlorophenyl)sulfanylmethyl]-N-[(Z)-(3-fluorophenyl)methylideneamino]triazole-4-carboxamide