| MolName | [2-bromo-4-nitro-6-[(Z)-[[2-(2,4,6-tribromophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-bromobenzoate |
| MolecularFormula | C22H12N3O6Br5 |
| Smiles | [O-][N+](c(cc1Br)cc(/C=N\NC(COc(c(Br)cc(Br)c2)c2Br)=O)c1OC(c(cc1)ccc1Br)=O)=O |
| InChI | InChI=1S/C22H12Br5N3O6/c23-13-3-1-11(2-4-13)22(32)36-20-12(5-15(30(33)34)8-18(20)27)9-28-29-19(31)10-35-21-16(25)6-14(24)7-17(21)26/h1-9H,10H2,(H,29,31) |
| InChIK | UXCFFWKLKTWXGI-UHFFFAOYSA-N |
| TotalMolweight | 813.872 |
| Molweight | 813.872 |
| MonoisotopicMass | 808.664292 |
| CLogP | 6.9114 |
| CLogS | -9.601 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 415.08 |
| Relative PSA | 0.23964 |
| PolarSurfaceArea | 122.81 |
| Druglikeness | -2.8759 |
| Mutagenic | low |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde; polyhalo aromatic ring |
| Shape Index | 0.55556 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| Rotatable Bond | 9 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 4 |
| Symmetricatoms | 5 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - [2-bromo-4-nitro-6-[(Z)-[[2-(2,4,6-tribromophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-bromobenzoate | 2 - [2-bromo-4-nitro-6-[(Z)-[[2-(2,4,6-tribromophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-bromobenzoate