| MolName | N-[(Z)-[4-(3-fluoropropoxy)phenyl]methylideneamino]-2,5-bis(2,2,2-trifluoroethoxy)benzamide |
| MolecularFormula | C21H19N2O4F7 |
| Smiles | O=C(c(cc(cc1)OCC(F)(F)F)c1OCC(F)(F)F)N/N=C\c(cc1)ccc1OCCCF |
| InChI | InChI=1S/C21H19F7N2O4/c22-8-1-9-32-15-4-2-14(3-5-15)11-29-30-19(31)17-10-16(33-12-20(23,24)25)6-7-18(17)34-13-21(26,27)28/h2-7,10-11H,1,8-9,12-13H2,(H,30,31) |
| InChIK | UXEPHHLMWNZPJU-UHFFFAOYSA-N |
| TotalMolweight | 496.378 |
| Molweight | 496.378 |
| MonoisotopicMass | 496.123304 |
| CLogP | 5.4079 |
| CLogS | -6.5 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 351.06 |
| Relative PSA | 0.18803 |
| PolarSurfaceArea | 69.15 |
| Druglikeness | -3.0662 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.58824 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 13 |
| Electronegative Atoms | 13 |
| Rotatable Bond | 13 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 10 |
| Symmetricatoms | 6 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[4-(3-fluoropropoxy)phenyl]methylideneamino]-2,5-bis(2,2,2-trifluoroethoxy)benzamide | 2 - N-[(Z)-[4-(3-fluoropropoxy)phenyl]methylideneamino]-2,5-bis(2,2,2-trifluoroethoxy)benzamide