| MolName | 2-[(Z)-[[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-phenyltriazole-4-carbonyl]hydrazinylidene]methyl]-4-nitrophenolate |
| MolecularFormula | C18H12N9O5 |
| Smiles | Nc1nonc1-n1nnc(C(N/N=C\c(cc(cc2)[N+]([O-])=O)c2[O-])=O)c1-c1ccccc1 |
| InChI | InChI=1S/C18H13N9O5/c19-16-17(24-32-23-16)26-15(10-4-2-1-3-5-10)14(21-25-26)18(29)22-20-9-11-8-12(27(30)31)6-7-13(11)28/h1-9,28H,(H2,19,23)(H,22,29)/p-1 |
| InChIK | UYTGVXLKEXJBIN-UHFFFAOYSA-M |
| TotalMolweight | 434.351 |
| Molweight | 434.351 |
| MonoisotopicMass | 434.096141 |
| CLogP | 0.6003 |
| CLogS | -3.37 |
| H Acceptors | 14 |
| H Donors | 2 |
| TotalSurfaceArea | 320.16 |
| Relative PSA | 0.50237 |
| PolarSurfaceArea | 205.99 |
| Druglikeness | -3.0978 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.46875 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 5 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(Z)-[[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-phenyltriazole-4-carbonyl]hydrazinylidene]methyl]-4-nitrophenolate | 2 - 2-[(Z)-[[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-phenyltriazole-4-carbonyl]hydrazinylidene]methyl]-4-nitrophenolate