| MolName | 5,7-dichloro-2-[(2Z)-2-[[4-(trifluoromethoxy)phenyl]methylidene]hydrazinyl]quinolin-8-ol |
| MolecularFormula | C17H10N3O2Cl2F3 |
| Smiles | Oc(c1nc(N/N=C\c(cc2)ccc2OC(F)(F)F)ccc1c(Cl)c1)c1Cl |
| InChI | InChI=1S/C17H10Cl2F3N3O2/c18-12-7-13(19)16(26)15-11(12)5-6-14(24-15)25-23-8-9-1-3-10(4-2-9)27-17(20,21)22/h1-8,26H,(H,24,25) |
| InChIK | UYTKLJKLFLMMIF-UHFFFAOYSA-N |
| TotalMolweight | 416.185 |
| Molweight | 416.185 |
| MonoisotopicMass | 415.010215 |
| CLogP | 7.4736 |
| CLogS | -6.579 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 279.25 |
| Relative PSA | 0.20426 |
| PolarSurfaceArea | 66.74 |
| Druglikeness | -5.9994 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.59259 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 3 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 5,7-dichloro-2-[(2Z)-2-[[4-(trifluoromethoxy)phenyl]methylidene]hydrazinyl]quinolin-8-ol | 2 - 5,7-dichloro-2-[(2Z)-2-[[4-(trifluoromethoxy)phenyl]methylidene]hydrazinyl]quinolin-8-ol