| MolName | 3-[5-[(Z)-[[2-(4-bromophenyl)acetyl]hydrazinylidene]methyl]furan-2-yl]benzoate |
| MolecularFormula | C20H14N2O4Br |
| Smiles | [O-]C(c1cccc(-c2ccc(/C=N\NC(Cc(cc3)ccc3Br)=O)o2)c1)=O |
| InChI | InChI=1S/C20H15BrN2O4/c21-16-6-4-13(5-7-16)10-19(24)23-22-12-17-8-9-18(27-17)14-2-1-3-15(11-14)20(25)26/h1-9,11-12H,10H2,(H,23,24)(H,25,26)/p-1 |
| InChIK | UYXLZFYCFMBWSO-UHFFFAOYSA-M |
| TotalMolweight | 426.245 |
| Molweight | 426.245 |
| MonoisotopicMass | 425.013694 |
| CLogP | 2.2729 |
| CLogS | -5.993 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 294.11 |
| Relative PSA | 0.2633 |
| PolarSurfaceArea | 94.73 |
| Druglikeness | 4.7247 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[5-[(Z)-[[2-(4-bromophenyl)acetyl]hydrazinylidene]methyl]furan-2-yl]benzoate | 2 - 3-[5-[(Z)-[[2-(4-bromophenyl)acetyl]hydrazinylidene]methyl]furan-2-yl]benzoate