| MolName | N-[(Z)-(3-bromophenyl)methylideneamino]-4-[2-[(2Z)-2-[(3-bromophenyl)methylidene]hydrazinyl]-2-oxoethoxy]benzamide |
| MolecularFormula | C23H18N4O3Br2 |
| Smiles | O=C(COc(cc1)ccc1C(N/N=C\c1cccc(Br)c1)=O)N/N=C\c1cc(Br)ccc1 |
| InChI | InChI=1S/C23H18Br2N4O3/c24-19-5-1-3-16(11-19)13-26-28-22(30)15-32-21-9-7-18(8-10-21)23(31)29-27-14-17-4-2-6-20(25)12-17/h1-14H,15H2,(H,28,30)(H,29,31) |
| InChIK | UYZXKDMFLNPAOJ-UHFFFAOYSA-N |
| TotalMolweight | 558.229 |
| Molweight | 558.229 |
| MonoisotopicMass | 555.974563 |
| CLogP | 5.7689 |
| CLogS | -7.274 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 361.74 |
| Relative PSA | 0.22674 |
| PolarSurfaceArea | 92.15 |
| Druglikeness | 2.4066 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.6875 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(3-bromophenyl)methylideneamino]-4-[2-[(2Z)-2-[(3-bromophenyl)methylidene]hydrazinyl]-2-oxoethoxy]benzamide | 2 - N-[(Z)-(3-bromophenyl)methylideneamino]-4-[2-[(2Z)-2-[(3-bromophenyl)methylidene]hydrazinyl]-2-oxoethoxy]benzamide