| MolName | (Z)-N-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-1-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methanimine |
| MolecularFormula | C25H24N5ClS |
| Smiles | Clc1ccc(CN(CC2)CCN2/N=C\c2cn(-c3ccccc3)nc2-c2cccs2)cc1 |
| InChI | InChI=1S/C25H24ClN5S/c26-22-10-8-20(9-11-22)18-29-12-14-30(15-13-29)27-17-21-19-31(23-5-2-1-3-6-23)28-25(21)24-7-4-16-32-24/h1-11,16-17,19H,12-15,18H2 |
| InChIK | UZJCXYKKLOXLRZ-UHFFFAOYSA-N |
| TotalMolweight | 462.02 |
| Molweight | 462.02 |
| MonoisotopicMass | 461.144092 |
| CLogP | 4.5675 |
| CLogS | -4.826 |
| H Acceptors | 5 |
| TotalSurfaceArea | 352.52 |
| Relative PSA | 0.16115 |
| PolarSurfaceArea | 64.9 |
| Druglikeness | 8.4287 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.59375 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 7 |
| Symmetricatoms | 6 |
| Amines | 1 |
| AlkylAmines | 1 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-N-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-1-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methanimine | 2 - (Z)-N-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-1-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methanimine