| MolName | 4-(2,4-dichlorophenoxy)-N-[2-[(2Z)-2-[(3-hydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]butanamide |
| MolecularFormula | C19H19N3O4Cl2 |
| Smiles | Oc1cccc(/C=N\NC(CNC(CCCOc(ccc(Cl)c2)c2Cl)=O)=O)c1 |
| InChI | InChI=1S/C19H19Cl2N3O4/c20-14-6-7-17(16(21)10-14)28-8-2-5-18(26)22-12-19(27)24-23-11-13-3-1-4-15(25)9-13/h1,3-4,6-7,9-11,25H,2,5,8,12H2,(H,22,26)(H,24,27) |
| InChIK | UZPWJSKZDOGDMF-UHFFFAOYSA-N |
| TotalMolweight | 424.283 |
| Molweight | 424.283 |
| MonoisotopicMass | 423.075261 |
| CLogP | 3.6353 |
| CLogS | -4.984 |
| H Acceptors | 7 |
| H Donors | 3 |
| TotalSurfaceArea | 318.43 |
| Relative PSA | 0.26257 |
| PolarSurfaceArea | 100.02 |
| Druglikeness | 1.326 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.71429 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 9 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 6 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-(2,4-dichlorophenoxy)-N-[2-[(2Z)-2-[(3-hydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]butanamide | 2 - 4-(2,4-dichlorophenoxy)-N-[2-[(2Z)-2-[(3-hydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]butanamide