| MolName | N-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]-1H-indole-3-carboxamide |
| MolecularFormula | C20H20N4O2 |
| Smiles | O=C(c1c[nH]c2c1cccc2)N/N=C\c(cc1)ccc1N1CCOCC1 |
| InChI | InChI=1S/C20H20N4O2/c25-20(18-14-21-19-4-2-1-3-17(18)19)23-22-13-15-5-7-16(8-6-15)24-9-11-26-12-10-24/h1-8,13-14,21H,9-12H2,(H,23,25) |
| InChIK | UZSLAUWLNAFBHX-UHFFFAOYSA-N |
| TotalMolweight | 348.405 |
| Molweight | 348.405 |
| MonoisotopicMass | 348.158626 |
| CLogP | 2.91 |
| CLogS | -4.349 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 273 |
| Relative PSA | 0.23278 |
| PolarSurfaceArea | 69.72 |
| Druglikeness | 6.0126 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65385 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Sp3Atoms | 5 |
| Symmetricatoms | 4 |
| Amines | 1 |
| Aromatic Amines | 1 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]-1H-indole-3-carboxamide | 2 - N-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]-1H-indole-3-carboxamide