| MolName | [3-(4-chlorobenzoyl)oxy-4-[(Z)-[(3-chlorophenyl)carbamothioylhydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
| MolecularFormula | C28H18N3O4Cl3S |
| Smiles | O=C(c(cc1)ccc1Cl)Oc1cc(OC(c(cc2)ccc2Cl)=O)c(/C=N\NC(Nc2cccc(Cl)c2)=S)cc1 |
| InChI | InChI=1S/C28H18Cl3N3O4S/c29-20-9-4-17(5-10-20)26(35)37-24-13-8-19(16-32-34-28(39)33-23-3-1-2-22(31)14-23)25(15-24)38-27(36)18-6-11-21(30)12-7-18/h1-16H,(H2,33,34,39) |
| InChIK | UZWDLILVUXKSRO-UHFFFAOYSA-N |
| TotalMolweight | 598.893 |
| Molweight | 598.893 |
| MonoisotopicMass | 597.008358 |
| CLogP | 8.2712 |
| CLogS | -9.469 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 434.69 |
| Relative PSA | 0.24963 |
| PolarSurfaceArea | 121.11 |
| Druglikeness | 2.0847 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.51282 |
| Fragments | 1 |
| Non HAtoms | 39 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 9 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 3 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - [3-(4-chlorobenzoyl)oxy-4-[(Z)-[(3-chlorophenyl)carbamothioylhydrazinylidene]methyl]phenyl] 4-chlorobenzoate | 2 - [3-(4-chlorobenzoyl)oxy-4-[(Z)-[(3-chlorophenyl)carbamothioylhydrazinylidene]methyl]phenyl] 4-chlorobenzoate