| MolName | N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-2-(3-oxo-1,4-benzothiazin-4-yl)acetamide |
| MolecularFormula | C17H13N3O2Cl2S |
| Smiles | O=C(CN1c(cccc2)c2SCC1=O)N/N=C\c(ccc(Cl)c1)c1Cl |
| InChI | InChI=1S/C17H13Cl2N3O2S/c18-12-6-5-11(13(19)7-12)8-20-21-16(23)9-22-14-3-1-2-4-15(14)25-10-17(22)24/h1-8H,9-10H2,(H,21,23) |
| InChIK | VAAVCYAGSKLIRF-UHFFFAOYSA-N |
| TotalMolweight | 394.281 |
| Molweight | 394.281 |
| MonoisotopicMass | 393.010551 |
| CLogP | 2.9008 |
| CLogS | -5.899 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 277.39 |
| Relative PSA | 0.25268 |
| PolarSurfaceArea | 87.07 |
| Druglikeness | 6.8192 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 3 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-2-(3-oxo-1,4-benzothiazin-4-yl)acetamide | 2 - N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-2-(3-oxo-1,4-benzothiazin-4-yl)acetamide