| MolName | N,N'-bis[(Z)-(4-fluorophenyl)methylideneamino]octanediamide |
| MolecularFormula | C22H24N4O2F2 |
| Smiles | O=C(CCCCCCC(N/N=C\c(cc1)ccc1F)=O)N/N=C\c(cc1)ccc1F |
| InChI | InChI=1S/C22H24F2N4O2/c23-19-11-7-17(8-12-19)15-25-27-21(29)5-3-1-2-4-6-22(30)28-26-16-18-9-13-20(24)14-10-18/h7-16H,1-6H2,(H,27,29)(H,28,30) |
| InChIK | VAGWLXOQQPUTRC-UHFFFAOYSA-N |
| TotalMolweight | 414.455 |
| Molweight | 414.455 |
| MonoisotopicMass | 414.186732 |
| CLogP | 5.4664 |
| CLogS | -6.366 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 336.22 |
| Relative PSA | 0.2142 |
| PolarSurfaceArea | 82.92 |
| Druglikeness | -5.4695 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.8 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 11 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 6 |
| Symmetricatoms | 17 |
| StereoCon |
Click to Load Molecule:
1 - N,N'-bis[(Z)-(4-fluorophenyl)methylideneamino]octanediamide | 2 - N,N'-bis[(Z)-(4-fluorophenyl)methylideneamino]octanediamide