| MolName | 3-[(Z)-naphthalen-2-ylmethylideneamino]-1,3-diazaspiro[4.5]decane-2,4-dione |
| MolecularFormula | C19H19N3O2 |
| Smiles | O=C(C1(CCCCC1)NC1=O)N1/N=C\c1cc2ccccc2cc1 |
| InChI | InChI=1S/C19H19N3O2/c23-17-19(10-4-1-5-11-19)21-18(24)22(17)20-13-14-8-9-15-6-2-3-7-16(15)12-14/h2-3,6-9,12-13H,1,4-5,10-11H2,(H,21,24) |
| InChIK | VAUXQZOTRJYLAE-UHFFFAOYSA-N |
| TotalMolweight | 321.379 |
| Molweight | 321.379 |
| MonoisotopicMass | 321.147727 |
| CLogP | 3.3452 |
| CLogS | -5.342 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 242.09 |
| Relative PSA | 0.21727 |
| PolarSurfaceArea | 61.77 |
| Druglikeness | 1.5523 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.58333 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 2 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 10 |
| Sp3Atoms | 6 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(Z)-naphthalen-2-ylmethylideneamino]-1,3-diazaspiro[4.5]decane-2,4-dione | 2 - 3-[(Z)-naphthalen-2-ylmethylideneamino]-1,3-diazaspiro[4.5]decane-2,4-dione