| MolName | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-5-(4-nitrophenyl)triazole-4-carboxamide |
| MolecularFormula | C19H13N9O6 |
| Smiles | Nc1nonc1-n1nnc(C(N/N=C\c(cc2)cc3c2OCO3)=O)c1-c(cc1)ccc1[N+]([O-])=O |
| InChI | InChI=1S/C19H13N9O6/c20-17-18(25-34-24-17)27-16(11-2-4-12(5-3-11)28(30)31)15(22-26-27)19(29)23-21-8-10-1-6-13-14(7-10)33-9-32-13/h1-8H,9H2,(H2,20,24)(H,23,29) |
| InChIK | VBKQKJKMIJKVIQ-UHFFFAOYSA-N |
| TotalMolweight | 463.369 |
| Molweight | 463.369 |
| MonoisotopicMass | 463.098881 |
| CLogP | 2.6354 |
| CLogS | -4.377 |
| H Acceptors | 15 |
| H Donors | 2 |
| TotalSurfaceArea | 332.89 |
| Relative PSA | 0.50035 |
| PolarSurfaceArea | 201.39 |
| Druglikeness | -3.1839 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 15 |
| Electronegative Atoms | 15 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 5 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-5-(4-nitrophenyl)triazole-4-carboxamide | 2 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-5-(4-nitrophenyl)triazole-4-carboxamide