| MolName | [4-bromo-2-[(Z)-[[2-(naphthalen-2-ylamino)acetyl]hydrazinylidene]methyl]phenyl] (E)-3-(furan-2-yl)prop-2-enoate |
| MolecularFormula | C26H20N3O4Br |
| Smiles | O=C(CNc1cc2ccccc2cc1)N/N=C\c(cc(cc1)Br)c1OC(/C=C/c1ccco1)=O |
| InChI | InChI=1S/C26H20BrN3O4/c27-21-8-11-24(34-26(32)12-10-23-6-3-13-33-23)20(14-21)16-29-30-25(31)17-28-22-9-7-18-4-1-2-5-19(18)15-22/h1-16,28H,17H2,(H,30,31) |
| InChIK | VBOXYIBKQIKQFO-UHFFFAOYSA-N |
| TotalMolweight | 518.366 |
| Molweight | 518.366 |
| MonoisotopicMass | 517.063718 |
| CLogP | 5.3615 |
| CLogS | -7.505 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 369.14 |
| Relative PSA | 0.22924 |
| PolarSurfaceArea | 92.93 |
| Druglikeness | 0.71804 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.61765 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 9 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 2 |
| Amines | 1 |
| Aromatic Amines | 1 |
| StereoCon |
Click to Load Molecule:
1 - [4-bromo-2-[(Z)-[[2-(naphthalen-2-ylamino)acetyl]hydrazinylidene]methyl]phenyl] (E)-3-(furan-2-yl)prop-2-enoate | 2 - [4-bromo-2-[(Z)-[[2-(naphthalen-2-ylamino)acetyl]hydrazinylidene]methyl]phenyl] (E)-3-(furan-2-yl)prop-2-enoate