| MolName | 2-[(2-naphthalen-2-yloxyacetyl)amino]-N-[(Z)-thiophen-2-ylmethylideneamino]acetamide |
| MolecularFormula | C19H17N3O3S |
| Smiles | O=C(CNC(COc1cc2ccccc2cc1)=O)N/N=C\c1cccs1 |
| InChI | InChI=1S/C19H17N3O3S/c23-18(22-21-11-17-6-3-9-26-17)12-20-19(24)13-25-16-8-7-14-4-1-2-5-15(14)10-16/h1-11H,12-13H2,(H,20,24)(H,22,23) |
| InChIK | VBUKBYPEUDPNAY-UHFFFAOYSA-N |
| TotalMolweight | 367.428 |
| Molweight | 367.428 |
| MonoisotopicMass | 367.099062 |
| CLogP | 2.9212 |
| CLogS | -4.884 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 284.26 |
| Relative PSA | 0.31967 |
| PolarSurfaceArea | 108.03 |
| Druglikeness | 6.7812 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.69231 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Sp3Atoms | 3 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(2-naphthalen-2-yloxyacetyl)amino]-N-[(Z)-thiophen-2-ylmethylideneamino]acetamide | 2 - 2-[(2-naphthalen-2-yloxyacetyl)amino]-N-[(Z)-thiophen-2-ylmethylideneamino]acetamide