| MolName | 3-carbazol-9-yl-N-[(Z)-(2-chloro-6-fluorophenyl)methylideneamino]propanamide |
| MolecularFormula | C22H17N3OClF |
| Smiles | O=C(CCn1c(cccc2)c2c2c1cccc2)N/N=C\c(c(F)ccc1)c1Cl |
| InChI | InChI=1S/C22H17ClFN3O/c23-18-8-5-9-19(24)17(18)14-25-26-22(28)12-13-27-20-10-3-1-6-15(20)16-7-2-4-11-21(16)27/h1-11,14H,12-13H2,(H,26,28) |
| InChIK | VBVKMIRTEFNVJR-UHFFFAOYSA-N |
| TotalMolweight | 393.848 |
| Molweight | 393.848 |
| MonoisotopicMass | 393.104417 |
| CLogP | 5.3465 |
| CLogS | -6.197 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 294.68 |
| Relative PSA | 0.14551 |
| PolarSurfaceArea | 46.39 |
| Druglikeness | 4.7609 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.53571 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 19 |
| Sp3Atoms | 2 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-carbazol-9-yl-N-[(Z)-(2-chloro-6-fluorophenyl)methylideneamino]propanamide | 2 - 3-carbazol-9-yl-N-[(Z)-(2-chloro-6-fluorophenyl)methylideneamino]propanamide