| MolName | 4-[(2Z)-2-[[5-(3-chlorophenyl)furan-2-yl]methylidene]hydrazinyl]benzenesulfonamide |
| MolecularFormula | C17H14N3O3ClS |
| Smiles | NS(c(cc1)ccc1N/N=C\c1ccc(-c2cccc(Cl)c2)o1)(=O)=O |
| InChI | InChI=1S/C17H14ClN3O3S/c18-13-3-1-2-12(10-13)17-9-6-15(24-17)11-20-21-14-4-7-16(8-5-14)25(19,22)23/h1-11,21H,(H2,19,22,23) |
| InChIK | VDCPZBJGZSMDPI-UHFFFAOYSA-N |
| TotalMolweight | 375.835 |
| Molweight | 375.835 |
| MonoisotopicMass | 375.044439 |
| CLogP | 5.1498 |
| CLogS | -5.244 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 271.21 |
| Relative PSA | 0.2984 |
| PolarSurfaceArea | 106.07 |
| Druglikeness | 5.7092 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.64 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 1 |
| Symmetricatoms | 3 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(2Z)-2-[[5-(3-chlorophenyl)furan-2-yl]methylidene]hydrazinyl]benzenesulfonamide | 2 - 4-[(2Z)-2-[[5-(3-chlorophenyl)furan-2-yl]methylidene]hydrazinyl]benzenesulfonamide