| MolName | N-[(Z)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]-4-phenyl-1,3-thiazol-2-amine |
| MolecularFormula | C20H14N3OBrS |
| Smiles | Brc(cc1)ccc1-c1ccc(/C=N\Nc2nc(-c3ccccc3)cs2)o1 |
| InChI | InChI=1S/C20H14BrN3OS/c21-16-8-6-15(7-9-16)19-11-10-17(25-19)12-22-24-20-23-18(13-26-20)14-4-2-1-3-5-14/h1-13H,(H,23,24) |
| InChIK | VDHNZDKLEKVSHZ-UHFFFAOYSA-N |
| TotalMolweight | 424.321 |
| Molweight | 424.321 |
| MonoisotopicMass | 423.004093 |
| CLogP | 7.8805 |
| CLogS | -6.954 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 291.78 |
| Relative PSA | 0.23446 |
| PolarSurfaceArea | 78.66 |
| Druglikeness | 3.9453 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.69231 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]-4-phenyl-1,3-thiazol-2-amine | 2 - N-[(Z)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]-4-phenyl-1,3-thiazol-2-amine