| MolName | 2-[[4-[(Z)-(4-chlorophenyl)methylideneamino]-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(4-nitrophenyl)methylideneamino]acetamide |
| MolecularFormula | C23H17N8O3ClS |
| Smiles | [O-][N+](c1ccc(/C=N\NC(CSc2nnc(-c3ccncc3)n2/N=C\c(cc2)ccc2Cl)=O)cc1)=O |
| InChI | InChI=1S/C23H17ClN8O3S/c24-19-5-1-17(2-6-19)14-27-31-22(18-9-11-25-12-10-18)29-30-23(31)36-15-21(33)28-26-13-16-3-7-20(8-4-16)32(34)35/h1-14H,15H2,(H,28,33) |
| InChIK | VDVWDAPYDIRTRH-UHFFFAOYSA-N |
| TotalMolweight | 520.96 |
| Molweight | 520.96 |
| MonoisotopicMass | 520.083284 |
| CLogP | 3.5517 |
| CLogS | -9.272 |
| H Acceptors | 11 |
| H Donors | 1 |
| TotalSurfaceArea | 387.09 |
| Relative PSA | 0.3493 |
| PolarSurfaceArea | 168.54 |
| Druglikeness | 0.73028 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.58333 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 13 |
| Electronegative Atoms | 13 |
| Rotatable Bond | 9 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 3 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 4 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[[4-[(Z)-(4-chlorophenyl)methylideneamino]-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(4-nitrophenyl)methylideneamino]acetamide | 2 - 2-[[4-[(Z)-(4-chlorophenyl)methylideneamino]-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(4-nitrophenyl)methylideneamino]acetamide