| MolName | N-(1,3-benzodioxol-5-yl)-2-[3-[(Z)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]indol-1-yl]acetamide |
| MolecularFormula | C25H19N5O3S |
| Smiles | O=C(Cn1c(cccc2)c2c(/C=N\Nc2nc(cccc3)c3s2)c1)Nc(cc1)cc2c1OCO2 |
| InChI | InChI=1S/C25H19N5O3S/c31-24(27-17-9-10-21-22(11-17)33-15-32-21)14-30-13-16(18-5-1-3-7-20(18)30)12-26-29-25-28-19-6-2-4-8-23(19)34-25/h1-13H,14-15H2,(H,27,31)(H,28,29) |
| InChIK | VDVWRSOQZVJASJ-UHFFFAOYSA-N |
| TotalMolweight | 469.524 |
| Molweight | 469.524 |
| MonoisotopicMass | 469.12086 |
| CLogP | 6.569 |
| CLogS | -5.994 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 345.33 |
| Relative PSA | 0.306 |
| PolarSurfaceArea | 118.01 |
| Druglikeness | 5.5961 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.55882 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 4 |
| Amides | 1 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-(1,3-benzodioxol-5-yl)-2-[3-[(Z)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]indol-1-yl]acetamide | 2 - N-(1,3-benzodioxol-5-yl)-2-[3-[(Z)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]indol-1-yl]acetamide