| MolName | 2-(1-benzylbenzimidazol-2-yl)sulfanyl-N-[(Z)-thiophen-2-ylmethylideneamino]acetamide |
| MolecularFormula | C21H18N4OS2 |
| Smiles | O=C(CSc1nc(cccc2)c2n1Cc1ccccc1)N/N=C\c1cccs1 |
| InChI | InChI=1S/C21H18N4OS2/c26-20(24-22-13-17-9-6-12-27-17)15-28-21-23-18-10-4-5-11-19(18)25(21)14-16-7-2-1-3-8-16/h1-13H,14-15H2,(H,24,26) |
| InChIK | VEKWCAYLGAOCTR-UHFFFAOYSA-N |
| TotalMolweight | 406.533 |
| Molweight | 406.533 |
| MonoisotopicMass | 406.092201 |
| CLogP | 4.613 |
| CLogS | -4.706 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 310.26 |
| Relative PSA | 0.29556 |
| PolarSurfaceArea | 112.82 |
| Druglikeness | 7.4542 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.57143 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 20 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-(1-benzylbenzimidazol-2-yl)sulfanyl-N-[(Z)-thiophen-2-ylmethylideneamino]acetamide | 2 - 2-(1-benzylbenzimidazol-2-yl)sulfanyl-N-[(Z)-thiophen-2-ylmethylideneamino]acetamide