| MolName | 4-[[2-[(Z)-(3-phenyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]phenoxy]methyl]benzoic acid |
| MolecularFormula | C23H18N4O3S |
| Smiles | OC(c1ccc(COc2c(/C=N\N(C(c3ccccc3)=NN3)C3=S)cccc2)cc1)=O |
| InChI | InChI=1S/C23H18N4O3S/c28-22(29)18-12-10-16(11-13-18)15-30-20-9-5-4-8-19(20)14-24-27-21(25-26-23(27)31)17-6-2-1-3-7-17/h1-14H,15H2,(H,26,31)(H,28,29) |
| InChIK | VELQYAZEYZCWEI-UHFFFAOYSA-N |
| TotalMolweight | 430.487 |
| Molweight | 430.487 |
| MonoisotopicMass | 430.109961 |
| CLogP | 4.1282 |
| CLogS | -5.805 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 329.34 |
| Relative PSA | 0.31023 |
| PolarSurfaceArea | 118.61 |
| Druglikeness | 3.1734 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.58065 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 4 |
| Symmetricatoms | 4 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[[2-[(Z)-(3-phenyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]phenoxy]methyl]benzoic acid | 2 - 4-[[2-[(Z)-(3-phenyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]phenoxy]methyl]benzoic acid