| MolName | 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(Z)-[5-bromo-2-[2-(2-prop-2-enylphenoxy)ethoxy]phenyl]methylideneamino]acetamide |
| MolecularFormula | C22H22N5O3BrS |
| Smiles | C=CCc(cccc1)c1OCCOc(cc1)c(/C=N\NC(Cc2nnc(N)s2)=O)cc1Br |
| InChI | InChI=1S/C22H22BrN5O3S/c1-2-5-15-6-3-4-7-18(15)30-10-11-31-19-9-8-17(23)12-16(19)14-25-26-20(29)13-21-27-28-22(24)32-21/h2-4,6-9,12,14H,1,5,10-11,13H2,(H2,24,28)(H,26,29) |
| InChIK | VENYLWKJCACWJB-UHFFFAOYSA-N |
| TotalMolweight | 516.419 |
| Molweight | 516.419 |
| MonoisotopicMass | 515.062671 |
| CLogP | 4.474 |
| CLogS | -5.783 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 366.94 |
| Relative PSA | 0.30953 |
| PolarSurfaceArea | 139.96 |
| Druglikeness | -5.8624 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.625 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 11 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 6 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(Z)-[5-bromo-2-[2-(2-prop-2-enylphenoxy)ethoxy]phenyl]methylideneamino]acetamide | 2 - 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(Z)-[5-bromo-2-[2-(2-prop-2-enylphenoxy)ethoxy]phenyl]methylideneamino]acetamide