| MolName | N-[(Z)-(4-piperidin-1-ylphenyl)methylideneamino]benzamide |
| MolecularFormula | C19H21N3O |
| Smiles | O=C(c1ccccc1)N/N=C\c(cc1)ccc1N1CCCCC1 |
| InChI | InChI=1S/C19H21N3O/c23-19(17-7-3-1-4-8-17)21-20-15-16-9-11-18(12-10-16)22-13-5-2-6-14-22/h1,3-4,7-12,15H,2,5-6,13-14H2,(H,21,23) |
| InChIK | VEXACTWYZPMMHL-UHFFFAOYSA-N |
| TotalMolweight | 307.396 |
| Molweight | 307.396 |
| MonoisotopicMass | 307.168462 |
| CLogP | 4.0346 |
| CLogS | -4.713 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 252.59 |
| Relative PSA | 0.15662 |
| PolarSurfaceArea | 44.7 |
| Druglikeness | 4.4118 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.69565 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 5 |
| Symmetricatoms | 6 |
| Amines | 1 |
| Aromatic Amines | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(4-piperidin-1-ylphenyl)methylideneamino]benzamide | 2 - N-[(Z)-(4-piperidin-1-ylphenyl)methylideneamino]benzamide