| MolName | 4-[(Z)-[2-(2,4-difluorophenyl)imino-4-(3-oxo-4H-1,4-benzoxazin-6-yl)-1,3-thiazol-3-yl]iminomethyl]benzonitrile |
| MolecularFormula | C25H15N5O2F2S |
| Smiles | N#Cc1ccc(/C=N\N(C(c(cc2)cc(N3)c2OCC3=O)=CS2)/C2=N/c(ccc(F)c2)c2F)cc1 |
| InChI | InChI=1S/C25H15F2N5O2S/c26-18-6-7-20(19(27)10-18)31-25-32(29-12-16-3-1-15(11-28)2-4-16)22(14-35-25)17-5-8-23-21(9-17)30-24(33)13-34-23/h1-10,12,14H,13H2,(H,30,33) |
| InChIK | VFAAEBXRISYVSY-UHFFFAOYSA-N |
| TotalMolweight | 487.489 |
| Molweight | 487.489 |
| MonoisotopicMass | 487.091451 |
| CLogP | 4.2636 |
| CLogS | -7.241 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 353.39 |
| Relative PSA | 0.26068 |
| PolarSurfaceArea | 115.38 |
| Druglikeness | -1.0354 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.45714 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 4 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-[2-(2,4-difluorophenyl)imino-4-(3-oxo-4H-1,4-benzoxazin-6-yl)-1,3-thiazol-3-yl]iminomethyl]benzonitrile | 2 - 4-[(Z)-[2-(2,4-difluorophenyl)imino-4-(3-oxo-4H-1,4-benzoxazin-6-yl)-1,3-thiazol-3-yl]iminomethyl]benzonitrile