| MolName | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(Z)-(4-phenylphenyl)methylideneamino]acetamide |
| MolecularFormula | C22H17N3OS2 |
| Smiles | O=C(CSc1nc(cccc2)c2s1)N/N=C\c(cc1)ccc1-c1ccccc1 |
| InChI | InChI=1S/C22H17N3OS2/c26-21(15-27-22-24-19-8-4-5-9-20(19)28-22)25-23-14-16-10-12-18(13-11-16)17-6-2-1-3-7-17/h1-14H,15H2,(H,25,26) |
| InChIK | VFMPELOUSDFLSC-UHFFFAOYSA-N |
| TotalMolweight | 403.529 |
| Molweight | 403.529 |
| MonoisotopicMass | 403.081302 |
| CLogP | 5.5755 |
| CLogS | -7.185 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 307.3 |
| Relative PSA | 0.27605 |
| PolarSurfaceArea | 107.89 |
| Druglikeness | 4.7928 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.67857 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(Z)-(4-phenylphenyl)methylideneamino]acetamide | 2 - 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(Z)-(4-phenylphenyl)methylideneamino]acetamide