| MolName | (Z)-1-(2-phenylmethoxyphenyl)-N-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]methanimine |
| MolecularFormula | C28H24N2O2 |
| Smiles | C(c1ccccc1)Oc1c(/C=N\N=C/c(cccc2)c2OCc2ccccc2)cccc1 |
| InChI | InChI=1S/C28H24N2O2/c1-3-11-23(12-4-1)21-31-27-17-9-7-15-25(27)19-29-30-20-26-16-8-10-18-28(26)32-22-24-13-5-2-6-14-24/h1-20H,21-22H2 |
| InChIK | VFWWLQPTOXHELN-UHFFFAOYSA-N |
| TotalMolweight | 420.511 |
| Molweight | 420.511 |
| MonoisotopicMass | 420.183778 |
| CLogP | 7.4818 |
| CLogS | -6.814 |
| H Acceptors | 4 |
| TotalSurfaceArea | 349.58 |
| Relative PSA | 0.12306 |
| PolarSurfaceArea | 43.18 |
| Druglikeness | 0.9501 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.625 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 9 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 4 |
| Symmetricatoms | 18 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-(2-phenylmethoxyphenyl)-N-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]methanimine | 2 - (Z)-1-(2-phenylmethoxyphenyl)-N-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]methanimine