| MolName | N-[(Z)-(1,2-diphenylindol-3-yl)methylideneamino]-3-morpholin-4-ylsulfonylbenzamide |
| MolecularFormula | C32H28N4O4S |
| Smiles | O=C(c1cccc(S(N2CCOCC2)(=O)=O)c1)N/N=C\c(c1c2cccc1)c(-c1ccccc1)n2-c1ccccc1 |
| InChI | InChI=1S/C32H28N4O4S/c37-32(25-12-9-15-27(22-25)41(38,39)35-18-20-40-21-19-35)34-33-23-29-28-16-7-8-17-30(28)36(26-13-5-2-6-14-26)31(29)24-10-3-1-4-11-24/h1-17,22-23H,18-21H2,(H,34,37) |
| InChIK | VFXNRVLRJQKJRF-UHFFFAOYSA-N |
| TotalMolweight | 564.664 |
| Molweight | 564.664 |
| MonoisotopicMass | 564.183126 |
| CLogP | 5.4964 |
| CLogS | -8.519 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 420.73 |
| Relative PSA | 0.20205 |
| PolarSurfaceArea | 101.38 |
| Druglikeness | 2.0514 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.46341 |
| Fragments | 1 |
| Non HAtoms | 41 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 27 |
| Sp3Atoms | 6 |
| Symmetricatoms | 7 |
| Amides | 1 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(1,2-diphenylindol-3-yl)methylideneamino]-3-morpholin-4-ylsulfonylbenzamide | 2 - N-[(Z)-(1,2-diphenylindol-3-yl)methylideneamino]-3-morpholin-4-ylsulfonylbenzamide