| MolName | 3-[(2,5-dichlorophenyl)sulfamoyl]-N-[(Z)-(3-hydroxyphenyl)methylideneamino]benzamide |
| MolecularFormula | C20H15N3O4Cl2S |
| Smiles | Oc1cccc(/C=N\NC(c2cccc(S(Nc(cc(cc3)Cl)c3Cl)(=O)=O)c2)=O)c1 |
| InChI | InChI=1S/C20H15Cl2N3O4S/c21-15-7-8-18(22)19(11-15)25-30(28,29)17-6-2-4-14(10-17)20(27)24-23-12-13-3-1-5-16(26)9-13/h1-12,25-26H,(H,24,27) |
| InChIK | VGZLCUWIEMHFHP-UHFFFAOYSA-N |
| TotalMolweight | 464.328 |
| Molweight | 464.328 |
| MonoisotopicMass | 463.016031 |
| CLogP | 4.367 |
| CLogS | -6.23 |
| H Acceptors | 7 |
| H Donors | 3 |
| TotalSurfaceArea | 323.98 |
| Relative PSA | 0.27517 |
| PolarSurfaceArea | 116.24 |
| Druglikeness | 1.5713 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.56667 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| Symmetricatoms | 1 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(2,5-dichlorophenyl)sulfamoyl]-N-[(Z)-(3-hydroxyphenyl)methylideneamino]benzamide | 2 - 3-[(2,5-dichlorophenyl)sulfamoyl]-N-[(Z)-(3-hydroxyphenyl)methylideneamino]benzamide