| MolName | 2-[2-nitro-4-(trifluoromethyl)phenyl]-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]acetamide |
| MolecularFormula | C18H14N3O3F3 |
| Smiles | [O-][N+](c1c(CC(N/N=C\C=C\c2ccccc2)=O)ccc(C(F)(F)F)c1)=O |
| InChI | InChI=1S/C18H14F3N3O3/c19-18(20,21)15-9-8-14(16(12-15)24(26)27)11-17(25)23-22-10-4-7-13-5-2-1-3-6-13/h1-10,12H,11H2,(H,23,25) |
| InChIK | VHNDPVKCBITAOS-UHFFFAOYSA-N |
| TotalMolweight | 377.321 |
| Molweight | 377.321 |
| MonoisotopicMass | 377.098726 |
| CLogP | 3.1447 |
| CLogS | -5.216 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 280.38 |
| Relative PSA | 0.23693 |
| PolarSurfaceArea | 87.28 |
| Druglikeness | -7.914 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.62963 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 7 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 3 |
| Symmetricatoms | 4 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[2-nitro-4-(trifluoromethyl)phenyl]-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]acetamide | 2 - 2-[2-nitro-4-(trifluoromethyl)phenyl]-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]acetamide