| MolName | [4-[(Z)-(pyridine-3-carbonylhydrazinylidene)methyl]phenyl] thiophene-2-carboxylate |
| MolecularFormula | C18H13N3O3S |
| Smiles | O=C(c1cccs1)Oc1ccc(/C=N\NC(c2cnccc2)=O)cc1 |
| InChI | InChI=1S/C18H13N3O3S/c22-17(14-3-1-9-19-12-14)21-20-11-13-5-7-15(8-6-13)24-18(23)16-4-2-10-25-16/h1-12H,(H,21,22) |
| InChIK | VHSCAGJSABXOCT-UHFFFAOYSA-N |
| TotalMolweight | 351.385 |
| Molweight | 351.385 |
| MonoisotopicMass | 351.067762 |
| CLogP | 3.4978 |
| CLogS | -4.406 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 269.2 |
| Relative PSA | 0.33574 |
| PolarSurfaceArea | 108.89 |
| Druglikeness | 5.9413 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.68 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - [4-[(Z)-(pyridine-3-carbonylhydrazinylidene)methyl]phenyl] thiophene-2-carboxylate | 2 - [4-[(Z)-(pyridine-3-carbonylhydrazinylidene)methyl]phenyl] thiophene-2-carboxylate