| MolName | [(E)-[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butylidene]amino]thiourea |
| MolecularFormula | C6H7N3OF6S |
| Smiles | NC(N/N=C/CC(C(F)(F)F)(C(F)(F)F)O)=S |
| InChI | InChI=1S/C6H7F6N3OS/c7-5(8,9)4(16,6(10,11)12)1-2-14-15-3(13)17/h2,16H,1H2,(H3,13,15,17) |
| InChIK | VIQYDOCFAGVYKQ-UHFFFAOYSA-N |
| TotalMolweight | 283.196 |
| Molweight | 283.196 |
| MonoisotopicMass | 283.0214 |
| CLogP | 1.0135 |
| CLogS | -3.38 |
| H Acceptors | 4 |
| H Donors | 3 |
| TotalSurfaceArea | 180.39 |
| Relative PSA | 0.43982 |
| PolarSurfaceArea | 102.73 |
| Druglikeness | -15.585 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.52941 |
| Fragments | 1 |
| Non HAtoms | 17 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 5 |
| Sp3Atoms | 6 |
| Symmetricatoms | 6 |
| StereoCon |
Click to Load Molecule:
1 - [(E)-[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butylidene]amino]thiourea | 2 - [(E)-[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butylidene]amino]thiourea