| MolName | (Z)-1-[3,5-dichloro-2-(2-phenoxyethoxy)phenyl]-N-(1,2,4-triazol-4-yl)methanimine |
| MolecularFormula | C17H14N4O2Cl2 |
| Smiles | Clc(cc1/C=N\n2cnnc2)cc(Cl)c1OCCOc1ccccc1 |
| InChI | InChI=1S/C17H14Cl2N4O2/c18-14-8-13(10-22-23-11-20-21-12-23)17(16(19)9-14)25-7-6-24-15-4-2-1-3-5-15/h1-5,8-12H,6-7H2 |
| InChIK | VIRMFYQNGNYLAH-UHFFFAOYSA-N |
| TotalMolweight | 377.23 |
| Molweight | 377.23 |
| MonoisotopicMass | 376.04938 |
| CLogP | 3.7953 |
| CLogS | -7.05 |
| H Acceptors | 6 |
| TotalSurfaceArea | 282.62 |
| Relative PSA | 0.21343 |
| PolarSurfaceArea | 61.53 |
| Druglikeness | -3.8015 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 4 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-[3,5-dichloro-2-(2-phenoxyethoxy)phenyl]-N-(1,2,4-triazol-4-yl)methanimine | 2 - (Z)-1-[3,5-dichloro-2-(2-phenoxyethoxy)phenyl]-N-(1,2,4-triazol-4-yl)methanimine