| MolName | 4-[(2,4-dimethoxyphenyl)methylideneamino]-3-ethyl-1H-1,2,4-triazole-5-thione |
| MolecularFormula | C13H16N4O2S |
| Smiles | CCC(N1N=Cc(ccc(OC)c2)c2OC)=NNC1=S |
| InChI | InChI=1S/C13H16N4O2S/c1-4-12-15-16-13(20)17(12)14-8-9-5-6-10(18-2)7-11(9)19-3/h5-8H,4H2,1-3H3,(H,16,20) |
| InChIK | VJANDMRLLFUEIT-UHFFFAOYSA-N |
| TotalMolweight | 292.362 |
| Molweight | 292.362 |
| MonoisotopicMass | 292.099396 |
| CLogP | 2.1909 |
| CLogS | -3.587 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 232.5 |
| Relative PSA | 0.37002 |
| PolarSurfaceArea | 90.54 |
| Druglikeness | 3.659 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 20 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 7 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(2,4-dimethoxyphenyl)methylideneamino]-3-ethyl-1H-1,2,4-triazole-5-thione | 2 - 4-[(2,4-dimethoxyphenyl)methylideneamino]-3-ethyl-1H-1,2,4-triazole-5-thione