| MolName | 4-amino-N'-[(Z)-furan-2-ylmethylideneamino]-1,2,5-oxadiazole-3-carboximidamide |
| MolecularFormula | C8H8N6O2 |
| Smiles | N/C(/c1nonc1N)=N/N=C\c1ccco1 |
| InChI | InChI=1S/C8H8N6O2/c9-7(6-8(10)14-16-13-6)12-11-4-5-2-1-3-15-5/h1-4H,(H2,9,12)(H2,10,14) |
| InChIK | VJZDDERIICWAFM-UHFFFAOYSA-N |
| TotalMolweight | 220.192 |
| Molweight | 220.192 |
| MonoisotopicMass | 220.070874 |
| CLogP | 1.3677 |
| CLogS | -2.447 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 174.69 |
| Relative PSA | 0.59374 |
| PolarSurfaceArea | 128.82 |
| Druglikeness | 2.3932 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.625 |
| Fragments | 1 |
| Non HAtoms | 16 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 10 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 4-amino-N'-[(Z)-furan-2-ylmethylideneamino]-1,2,5-oxadiazole-3-carboximidamide | 2 - 4-amino-N'-[(Z)-furan-2-ylmethylideneamino]-1,2,5-oxadiazole-3-carboximidamide