| MolName | 2-amino-N-[[(2S)-oxolan-2-yl]methyl]-1-[(Z)-pyridin-3-ylmethylideneamino]pyrrolo[3,2-b]quinoxaline-3-carboxamide |
| MolecularFormula | C22H21N7O2 |
| Smiles | Nc1c(C(NC[C@H]2OCCC2)=O)c2nc3ccccc3nc2n1/N=C\c1cnccc1 |
| InChI | InChI=1S/C22H21N7O2/c23-20-18(22(30)25-13-15-6-4-10-31-15)19-21(28-17-8-2-1-7-16(17)27-19)29(20)26-12-14-5-3-9-24-11-14/h1-3,5,7-9,11-12,15H,4,6,10,13,23H2,(H,25,30)/t15-/m0/s1 |
| InChIK | VKHKTMVQJKVGFU-HNNXBMFYSA-N |
| TotalMolweight | 415.456 |
| Molweight | 415.456 |
| MonoisotopicMass | 415.175673 |
| CLogP | 1.7526 |
| CLogS | -6.927 |
| H Acceptors | 9 |
| H Donors | 2 |
| TotalSurfaceArea | 314.23 |
| Relative PSA | 0.32161 |
| PolarSurfaceArea | 120.31 |
| Druglikeness | 4.3354 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.48387 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| StereoCenters | 1 |
| Rotatable Bond | 5 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 19 |
| Sp3Atoms | 7 |
| Amides | 1 |
| Aromatic Nitrogens | 4 |
| StereoCon | this enantiomer |
Click to Load Molecule:
1 - 2-amino-N-[[(2S)-oxolan-2-yl]methyl]-1-[(Z)-pyridin-3-ylmethylideneamino]pyrrolo[3,2-b]quinoxaline-3-carboxamide | 2 - 2-amino-N-[[(2S)-oxolan-2-yl]methyl]-1-[(Z)-pyridin-3-ylmethylideneamino]pyrrolo[3,2-b]quinoxaline-3-carboxamide