| MolName | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-5-(4-nitrophenyl)triazole-4-carboxamide |
| MolecularFormula | C19H12N10O8 |
| Smiles | Nc1nonc1-n1nnc(C(N/N=C\c(cc2OCOc2c2)c2[N+]([O-])=O)=O)c1-c(cc1)ccc1[N+]([O-])=O |
| InChI | InChI=1S/C19H12N10O8/c20-17-18(25-37-24-17)27-16(9-1-3-11(4-2-9)28(31)32)15(22-26-27)19(30)23-21-7-10-5-13-14(36-8-35-13)6-12(10)29(33)34/h1-7H,8H2,(H2,20,24)(H,23,30) |
| InChIK | VKJUYPCBKZXWCR-UHFFFAOYSA-N |
| TotalMolweight | 508.366 |
| Molweight | 508.366 |
| MonoisotopicMass | 508.08396 |
| CLogP | 1.7138 |
| CLogS | -4.837 |
| H Acceptors | 18 |
| H Donors | 2 |
| TotalSurfaceArea | 356.56 |
| Relative PSA | 0.55245 |
| PolarSurfaceArea | 247.21 |
| Druglikeness | -3.1839 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.45946 |
| Fragments | 1 |
| Non HAtoms | 37 |
| NonCHAtoms | 18 |
| Electronegative Atoms | 18 |
| Rotatable Bond | 7 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 5 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 5 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-5-(4-nitrophenyl)triazole-4-carboxamide | 2 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-5-(4-nitrophenyl)triazole-4-carboxamide