| MolName | [4-bromo-2-[(Z)-[[2-(4-chloro-2-nitrophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-bromobenzoate |
| MolecularFormula | C22H14N3O6Br2Cl |
| Smiles | [O-][N+](c(cc(cc1)Cl)c1OCC(N/N=C\c(cc(cc1)Br)c1OC(c(cc1)ccc1Br)=O)=O)=O |
| InChI | InChI=1S/C22H14Br2ClN3O6/c23-15-3-1-13(2-4-15)22(30)34-19-7-5-16(24)9-14(19)11-26-27-21(29)12-33-20-8-6-17(25)10-18(20)28(31)32/h1-11H,12H2,(H,27,29) |
| InChIK | VKKKBWFIHARCBK-UHFFFAOYSA-N |
| TotalMolweight | 611.629 |
| Molweight | 611.629 |
| MonoisotopicMass | 608.893786 |
| CLogP | 5.3418 |
| CLogS | -7.835 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 374.61 |
| Relative PSA | 0.26553 |
| PolarSurfaceArea | 122.81 |
| Druglikeness | -2.8167 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.58824 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 9 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - [4-bromo-2-[(Z)-[[2-(4-chloro-2-nitrophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-bromobenzoate | 2 - [4-bromo-2-[(Z)-[[2-(4-chloro-2-nitrophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-bromobenzoate