| MolName | N-benzyl-2-[(Z)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| MolecularFormula | C27H23N2O2BrS |
| Smiles | O=C(c1c(/N=C\c2ccc(-c(cc3)ccc3Br)o2)sc2c1CCCC2)NCc1ccccc1 |
| InChI | InChI=1S/C27H23BrN2O2S/c28-20-12-10-19(11-13-20)23-15-14-21(32-23)17-30-27-25(22-8-4-5-9-24(22)33-27)26(31)29-16-18-6-2-1-3-7-18/h1-3,6-7,10-15,17H,4-5,8-9,16H2,(H,29,31) |
| InChIK | VKNHJAFJDMYOCB-UHFFFAOYSA-N |
| TotalMolweight | 519.462 |
| Molweight | 519.462 |
| MonoisotopicMass | 518.066359 |
| CLogP | 6.7674 |
| CLogS | -8.032 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 366.07 |
| Relative PSA | 0.19253 |
| PolarSurfaceArea | 82.84 |
| Druglikeness | -0.56353 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.57576 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 5 |
| Symmetricatoms | 4 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-benzyl-2-[(Z)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide | 2 - N-benzyl-2-[(Z)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide